1719-71-7
Chemical Structure
Tetrazolium violet
Synonym(s): Violet tetrazolium
- CAS No.: 1719-71-7
- Formula:C23H17ClN4
- Molecular Weight:384.86
IUPAC Name: 3-(naphthalen-1-yl)-2,5-diphenyl-2H-tetrazol-3-ium chloride
InChIKey: RONADMZTCCPLEF-UHFFFAOYSA-M
SMILES: C1(C2=CC=CC=C2)=NN(C3=CC=CC=C3)[N+](C4=C5C=CC=CC5=CC=C4)=N1.[Cl-]
Biological Activity: Tetrazolium violet is a redox indicator commonly used in various biochemical assays to measure cell viability and metabolic activity. Tetrazolium Violet has unique chemical properties that allow it to be reduced by cellular enzymes such as dehydrogenases to form a purple formazan product that can be detected spectrophotometrically. This makes it a useful tool for assessing cell health and growth in culture or tissue samples.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Tetrazolium violet | 99.68% | Tetrazolium violet is a redox indicator commonly used in various biochemical assays to measure cell viability and metabolic activity. Tetrazolium Violet has unique chemical properties that allow it to be reduced by cellular enzymes such as dehydrogenases to form a purple formazan product that can be detected spectrophotometrically. This makes it a useful tool for assessing cell health and growth in culture or tissue samples. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||