176520-23-3
Chemical Structure
Azide-PEG2-MS
- CAS No.: 176520-23-3
- Formula:C5H11N3O4S
- Molecular Weight:209.22
IUPAC Name: 2-(2-azidoethoxy)ethyl methanesulfonate
InChIKey: WDDYPDGUFZTNJJ-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOS(C)(=O)=O
Biological Activity: Azide-PEG2-Ms is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azide-PEG2-Ms is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azide-PEG2-MS | 97.0% | Azide-PEG2-Ms is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azide-PEG2-Ms is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||