1804943-43-8
1804943-43-8
Chemical Structure
4-Methoxyacetophenone-d3
- CAS No.: 1804943-43-8
- Formula:C9H7D3O2
- Molecular Weight:153.19
InChIKey: NTPLXRHDUXRPNE-BMSJAHLVSA-N
SMILES: O=C(C)C1=CC=C(C=C1)OC([2H])([2H])[2H]
Biological Activity: 4-Methoxyacetophenone-d3 is the deuterated-labeled 4-Methoxyacetophenone (HY-Y0024). 4-Methoxyacetophenone is a versatile aromatic ketone that is widely used in the synthesis of various organic compounds. 4-Methoxyacetophenone has a pleasant aroma and can be used to create scents. 4-Methoxyacetophenone can also be used to make dyes and pigments.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
4-Methoxyacetophenone-d3 | 4-Methoxyacetophenone-d3 is the deuterated-labeled 4-Methoxyacetophenone (HY-Y0024). 4-Methoxyacetophenone is a versatile aromatic ketone that is widely used in the synthesis of various organic compounds. 4-Methoxyacetophenone has a pleasant aroma and can be used to create scents. 4-Methoxyacetophenone can also be used to make dyes and pigments. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
4-Methoxyacetophenone | 99.93% | 4-Methoxyacetophenone is a versatile aromatic ketone that is widely used in the synthesis of various organic compounds. 4-Methoxyacetophenone has a pleasant aroma and can be used to create scents. 4-Methoxyacetophenone can also be used to make dyes and pigments. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
4-Methoxyacetophenone (Standard) | ≥98% | 4-Methoxyacetophenone (Standard) is the analytical standard of 4-Methoxyacetophenone (HY-Y0024). This product is intended for research and analytical applications. 4-Methoxyacetophenone is a versatile aromatic ketone that is widely used in the synthesis of various organic compounds. 4-Methoxyacetophenone has a pleasant aroma and can be used to create scents. 4-Methoxyacetophenone can also be used to make dyes and pigments. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
