1807530-06-8
Chemical Structure
Azido-PEG1-NHS ester
- CAS No.: 1807530-06-8
- Formula:C9H12N4O5
- Molecular Weight:256.22
IUPAC Name: 2,5-dioxopyrrolidin-1-yl 3-(2-azidoethoxy)propanoate
InChIKey: MGKGKSFTIINDPY-UHFFFAOYSA-N
SMILES: O=C(ON1C(CCC1=O)=O)CCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG1-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG1-NHS ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG1-NHS ester | 99.78% | Azido-PEG1-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG1-NHS ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||