182760-73-2
Chemical Structure
Azido-PEG4-azide
- CAS No.: 182760-73-2
- Formula:C10H20N6O4
- Molecular Weight:288.30
IUPAC Name: 1,14-diazido-3,6,9,12-tetraoxatetradecane
InChIKey: QTEOEACEOUNLRG-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG4-azide is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Azido-PEG4-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG4-azide | 99.80% | Azido-PEG4-azide is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Azido-PEG4-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||