1831936-59-4
1831936-59-4
Chemical Structure
Bambulignan B
- CAS No.: 1831936-59-4
- Formula:C25H30O12
- Molecular Weight:522.50
InChIKey: IBVUYBLQWILUIV-VKLSRCDUSA-N
SMILES: OC[C@H]([C@H]([C@@H]([C@H]1O)O)O)O[C@@H]1O[C@@H](C2=CC(OC)=C(C=C2)O)[C@@H]3[C@@](C(OC3)=O)([H])[C@@H](C4=CC=C(C=C4)O)O
Biological Activity: Bambulignan B is a lignan glycoside found in the dried leaves of Pleioblastus amarus (Keng) keng f. Bambulignan B contains a β-D-glucopyranosyl O-glycosidic group attached at the C-7 position and a furanone structure linked to a 4-hydroxyphenyl group. Bambulignan B can be used in research related to lignan components and natural product chemistry[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Bambulignan B | Bambulignan B is a lignan glycoside found in the dried leaves of Pleioblastus amarus (Keng) keng f. Bambulignan B contains a β-D-glucopyranosyl O-glycosidic group attached at the C-7 position and a furanone structure linked to a 4-hydroxyphenyl group. Bambulignan B can be used in research related to lignan components and natural product chemistry. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
