184644-83-5
Chemical Structure
MTSES sodium
Synonym(s): Sodium (2-Sulfonatoethyl)methanethiosulfonate
- CAS No.: 184644-83-5
- Formula:C3H7NaO5S3
- Molecular Weight:242.27
IUPAC Name: sodium 2-((methylsulfonyl)thio)ethane-1-sulfonate
InChIKey: NZSYKLNULKPWIX-UHFFFAOYSA-M
SMILES: [O-]S(CCSS(C)(=O)=O)(=O)=O.[Na+]
Biological Activity: MTSES sodium (Sodium (2-Sulfonatoethyl)methanethiosulfonate) is a negatively charged, membrane-impermeable methanethiosulfonate (MTS). MTS is a compound that reacts with sulfhydryl groups to form mixed disulfide bonds and is often used to study cysteine ??residues on proteins.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
MTSES sodium | 98.0% | MTSES sodium (Sodium (2-Sulfonatoethyl)methanethiosulfonate) is a negatively charged, membrane-impermeable methanethiosulfonate (MTS). MTS is a compound that reacts with sulfhydryl groups to form mixed disulfide bonds and is often used to study cysteine ??residues on proteins. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||