185517-74-2
Chemical Structure
(S)-Rasagiline
Synonym(s): TVP1022; S-PAI
- CAS No.: 185517-74-2
- Formula:C12H13N
- Molecular Weight:171.24
IUPAC Name: (S)-N-(prop-2-yn-1-yl)-2,3-dihydro-1H-inden-1-amine
InChIKey: RUOKEQAAGRXIBM-LBPRGKRZSA-N
SMILES: C#CCN[C@H]1CCC2=CC=CC=C21
Biological Activity: (S)-Rasagiline (TVP1022) is the relatively inactive S-enantiomer form of Rasagiline. Rasagiline is a highly potent selective irreversible MAO inhibitor with IC50s of 4.43 nM and 412 nM for rat brain MAO B and A activity, respectively[1]. (S)-Rasagiline is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(S)-Rasagiline | 99.80% | (S)-Rasagiline (TVP1022) is the relatively inactive S-enantiomer form of Rasagiline. Rasagiline is a highly potent selective irreversible MAO inhibitor with IC50s of 4.43 nM and 412 nM for rat brain MAO B and A activity, respectively. (S)-Rasagiline is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||