1857352-95-4
Chemical Structure
Cy5.5 DBCO
- CAS. Nr.: 1857352-95-4
- Formula:C59H58N4O14S4
- Molecular Weight:1175.37
InChIKey: VTRGNBPOXZSARU-UHFFFAOYSA-N
SMILES: O=C(CCCCCN1C2=CC=C3C(C=C(S(=O)(O)=O)C=C3S(=O)(O)=O)=C2C(C)(C)/C1=C\C=C\C=C\C4=[N+](CC)C5=C(C4(C)C)C(C=C(S(=O)(O)=O)C=C6S(=O)([O-])=O)=C6C=C5)NCCC(N7C8=C(C#CC9=C(C7)C=CC=C9)C=CC=C8)=O
Biological Activity: Cy5.5 DBCO is a click chemistry reagent containing an cycloalkynes group. Cy5.5 DBCO is a linker of Cyanine5.5 fluorophore. DBCO group enables copper free biocompatible click chemistry with fast reaction kinetics and good stability[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cy5.5 DBCO | Cy5.5 DBCO is a click chemistry reagent containing an cycloalkynes group. Cy5.5 DBCO is a linker of Cyanine5.5 fluorophore. DBCO group enables copper free biocompatible click chemistry with fast reaction kinetics and good stability. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||