1887196-18-0
Chemical Structure
Ecdysoside B
- CAS No.: 1887196-18-0
- Formula:C42H62O13
- Molecular Weight:774.93
InChIKey: ZLVYLPKAALGUTL-IQPDWCRWSA-N
SMILES: O=C1O[C@H](C)[C@@]([C@]21C([C@]3([H])CC=C4C[C@@H](O[C@@H]5O[C@H](C)[C@@H](O[C@@H]6O[C@H](C)[C@@H](O[C@@H]7O[C@H](C)[C@@H](O)[C@H](OC)C7)[C@@H](OC)C6)[C@@H](OC)C5)CC[C@]4(C)[C@@]3([H])CC2)=C8)([H])C8=O
Biological Activity: Ecdysoside B (compound 6b) is a pregnanoside compound isolated from the plant Ecdysanthera rosea. Ecdysoside B and its derivatives and isomers shows anticancer, immunosuppressive and anti-inflammatory activities. Ecdysoside B shows cytotoxicity to a variety of human tumor cell lines, including PANC-1 (human pancreatic cancer cells), A375 (human melanoma cells) and U87 (brain glioma U87 cells). Ecdysoside B can be used for research in the areas of cancer, immunomodulation and anti-inflammato[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Ecdysoside B | Ecdysoside B (compound 6b) is a pregnanoside compound isolated from the plant Ecdysanthera rosea. Ecdysoside B and its derivatives and isomers shows anticancer, immunosuppressive and anti-inflammatory activities. Ecdysoside B shows cytotoxicity to a variety of human tumor cell lines, including PANC-1 (human pancreatic cancer cells), A375 (human melanoma cells) and U87 (brain glioma U87 cells). Ecdysoside B can be used for research in the areas of cancer, immunomodulation and anti-inflammato. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||