1932403-71-8
Chemical Structure
N3-L-Dab(Boc)-OH
- CAS No.: 1932403-71-8
- Formula:C9H16N4O4
- Molecular Weight:244.25
IUPAC Name: (S)-2-azido-4-((tert-butoxycarbonyl)amino)butanoic acid
InChIKey: JLMWKZYQNHSSAD-LURJTMIESA-N
SMILES: CC(C)(C)OC(NCC[C@@H](C(O)=O)N=[N+]=[N-])=O
Biological Activity: N3-L-Dab(Boc)-OH is a click chemistry reagent containing an azide group. N3-L-Dab(Boc)-OH can be used for the research of various biochemical[1]. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N3-L-Dab(Boc)-OH | N3-L-Dab(Boc)-OH is a click chemistry reagent containing an azide group. N3-L-Dab(Boc)-OH can be used for the research of various biochemical. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
