1932657-23-2
Chemical Structure
Z-L-Dbu(N3)-OH
- CAS No.: 1932657-23-2
- Formula:C12H14N4O4
- Molecular Weight:278.26
IUPAC Name: (S)-4-azido-3-(((benzyloxy)carbonyl)amino)butanoic acid
InChIKey: YHBFMNJJEQRLIV-JTQLQIEISA-N
SMILES: [N-]=[N+]=NC[C@H](CC(O)=O)NC(OCC1=CC=CC=C1)=O
Biological Activity: Z-L-Dbu(N3)-OH is a click chemistry reagent containing an Azide[1]. Z-L-Dbu(N3)-OH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Z-L-Dbu(N3)-OH | Z-L-Dbu(N3)-OH is a click chemistry reagent containing an Azide. Z-L-Dbu(N3)-OH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||