19485-76-8
Chemical Structure
Cholesteryl elaidate
Synonym(s): Cholesteryl trans-9-octadecenoate
- CAS No.: 19485-76-8
- Formula:C45H78O2
- Molecular Weight:651.10
IUPAC Name: (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-((R)-6-methylheptan-2-yl)-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl (E)-octadec-9-enoate
InChIKey: RJECHNNFRHZQKU-WYIFMRBMSA-N
SMILES: CCCCCCCC/C=C/CCCCCCCC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]32)C1
Biological Activity: Cholesteryl elaidate is an organic compound belonging to the class of esters. It is formed from the reaction between cholesterol and elaidic acid, producing a white crystalline solid with a mildly sweet taste. Cholesteryl elaidate has several applications in the pharmaceutical industry, particularly as a bioactive compound with potential research potential for improving a range of medical conditions, such as high cholesterol and inflammation-related diseases. Additionally, it has potential applications as a food additive to improve texture and stability.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cholesteryl elaidate | Cholesteryl elaidate is an organic compound belonging to the class of esters. It is formed from the reaction between cholesterol and elaidic acid, producing a white crystalline solid with a mildly sweet taste. Cholesteryl elaidate has several applications in the pharmaceutical industry, particularly as a bioactive compound with potential research potential for improving a range of medical conditions, such as high cholesterol and inflammation-related diseases. Additionally, it has potential applications as a food additive to improve texture and stability. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||