197457-99-1
Chemical Structure
Azedarachin B
- CAS No.: 197457-99-1
- Formula:C32H42O11
- Molecular Weight:602.67
IUPAC Name: (1S,2aR,3aS,3bS,4R,5aR,6R,7R,9S,9aS,9bR,11R,11aR,14S)-7-acetoxy-1-(furan-3-yl)-4,9,11-trihydroxy-3b,6,11a-trimethyl-10-oxotetradecahydro-1H-6,9a-(methanooxymethano)naphtho[1',2':6,7]indeno[1,7a-b]oxiren-14-yl isobutyrate
InChIKey: IWWHKSITDUTKRB-XAJGAXQBSA-N
SMILES: C[C@]12[C@]34[C@]([C@H](C5=COC=C5)C[C@@]3([H])O4)([C@H](C([C@]1([H])[C@@]67[C@@]([C@@]([C@@H](OC6)OC(C(C)C)=O)([C@@H](C[C@@H]7O)OC(C)=O)C)([H])C[C@H]2O)=O)O)C
Biological Activity: Azedarachin B is a tetranortriterpenoid limonoid analog that is isolated and extracted from the root bark of Melia toosendan and the roots of Melia azedarach. Azedarachin B exhibits potent insecticidal activity and tumor cytotoxicity. Azedarachin B can be used in research on cancer and biopesticides[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azedarachin B | Azedarachin B is a tetranortriterpenoid limonoid analog that is isolated and extracted from the root bark of Melia toosendan and the roots of Melia azedarach. Azedarachin B exhibits potent insecticidal activity and tumor cytotoxicity. Azedarachin B can be used in research on cancer and biopesticides. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
