19817-95-9
19817-95-9
Chemical Structure
Indole-3-acetyl β-D-glucopyranose
- CAS No.: 19817-95-9
- Formula:C16H19NO7
- Molecular Weight:337.32
InChIKey: HHDMMUWDSFASNB-JZYAIQKZSA-N
SMILES: OC[C@H]([C@H]([C@@H]([C@H]1O)O)O)O[C@H]1OC(CC2=CNC3=CC=CC=C23)=O
Biological Activity: Indole-3-acetyl β-D-glucopyranose is a glucose esterified derivative of the plant hormone indole-3-acetic acid (IAA). Indole-3-acetyl β-D-glucopyranose is involved in regulating plant growth and can be used to study the metabolism and regulatory mechanisms of plant hormones[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Indole-3-acetyl β-D-glucopyranose | Indole-3-acetyl β-D-glucopyranose is a glucose esterified derivative of the plant hormone indole-3-acetic acid (IAA). Indole-3-acetyl β-D-glucopyranose is involved in regulating plant growth and can be used to study the metabolism and regulatory mechanisms of plant hormones. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Indole-3-acetyl β-D-glucopyranose-d4 | Indole-3-acetyl β-D-glucopyranose-d4 is deuterium labeled Indole-3-acetyl β-D-glucopyranose. Indole-3-acetyl β-D-glucopyranose is a glucose esterified derivative of the plant hormone indole-3-acetic acid (IAA). Indole-3-acetyl β-D-glucopyranose is involved in regulating plant growth and can be used to study the metabolism and regulatory mechanisms of plant hormones. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
