199167-23-2
199167-23-2
Chemical Structure
Isocannflavin B
Synonym(s): Caflanone; FBL-03G
- CAS. Nr.: 199167-23-2
- Formula:C21H20O6
- Molecular Weight:368.38
InChIKey: IHRNYHWGJUMPFJ-UHFFFAOYSA-N
SMILES: O=C1C=C(C2=CC(OC)=C(O)C=C2)OC3=C(C/C=C(C)\C)C(O)=CC(O)=C31
Biological Activity: Isocannflavin B (Caflanone) is a flavonoid compound. Isocannflavin B exhibits anti-tumor and anti-viral activities. Isocannflavin B induces apoptosis, autophagy and cell cycle arrest in tumor cells, and inhibits cell proliferation. Isocannflavin B inhibits HCoV-OC43. Isocannflavin B can be used in research related to cancer and COVID-19[1][2][3].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Isocannflavin B | Isocannflavin B (Caflanone) is a flavonoid compound. Isocannflavin B exhibits anti-tumor and anti-viral activities. Isocannflavin B induces apoptosis, autophagy and cell cycle arrest in tumor cells, and inhibits cell proliferation. Isocannflavin B inhibits HCoV-OC43. Isocannflavin B can be used in research related to cancer and COVID-19. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
- [1]. Brunelli E, et al. Flavonoid-induced autophagy in hormone sensitive breast cancer cells. Fitoterapia. 2009;80(6):327-332. [Content Brief]
- [2]. Lowe H, et al. Non-Cannabinoid Metabolites of Cannabis sativa L. with Therapeutic Potential. Plants (Basel). 2021 Feb 20;10(2):400. [Content Brief]
- [3]. Holborn, Jennifer, et al. Preclinical Study of Cannflavins A and B Action Against Glioblastoma Cells. Phytomedicine Plus. 2026: 100967.
Keywords
