2022981-27-5
Chemical Structure
8-Anthracene-BODIPY 505/515-di(iodine)
- CAS No.: 2022981-27-5
- Formula:C27H21BF2I2N2
- Molecular Weight:676.09
InChIKey: YEQDGLPUKQGYPS-UHFFFAOYSA-N
SMILES: CC1=C(I)C(C)=[N]2[B+3]([F-])([F-])[N-]3C(C)=C(I)C(C)=C3C(C4=C5C=CC=CC5=CC6=C4C=CC=C6)=C12
Biological Activity: 8-Anthracene-BODIPY 505/515-di iodine (BDP-1) is an iodine-substituted BODIPY derivative and monomer for synthesis of conjugated porous polymer CPP-1. BODIPY dye is a small molecule dye with strong ultraviolet absorption ability, its fluorescence peak is relatively sharp, and the quantum yield is high (Ex/Em = 505/515 nm)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
8-Anthracene-BODIPY 505/515-di(iodine) | 8-Anthracene-BODIPY 505/515-di iodine (BDP-1) is an iodine-substituted BODIPY derivative and monomer for synthesis of conjugated porous polymer CPP-1. BODIPY dye is a small molecule dye with strong ultraviolet absorption ability, its fluorescence peak is relatively sharp, and the quantum yield is high (Ex/Em = 505/515 nm). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||