203640-27-1
Chemical Structure
S 3304
- CAS No.: 203640-27-1
- Formula:C24H20N2O4S2
- Molecular Weight:464.56
IUPAC Name: ((5-(p-tolylethynyl)thiophen-2-yl)sulfonyl)-D-tryptophan
InChIKey: YWCLDDLVLSQGSZ-JOCHJYFZSA-N
SMILES: O=S(N[C@@H](C(O)=O)CC1=CNC2=C1C=CC=C2)(C3=CC=C(C#CC4=CC=C(C)C=C4)S3)=O
Biological Activity: S 3304 is a novel matrix metalloproteinases (MMP) inhibitor specific for MMP-2 and MMP-9. S 3304 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
S 3304 | 99.75% | S 3304 is a novel matrix metalloproteinases (MMP) inhibitor specific for MMP-2 and MMP-9. S 3304 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
S 3304 (Standard) | S 3304 (Standard) is the analytical standard of S 3304 (HY-106992). This product is intended for research and analytical applications. S 3304 is a novel matrix metalloproteinases (MMP) inhibitor specific for MMP-2 and MMP-9. S 3304 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||