2055014-94-1
Chemical Structure
Propargyl-PEG8-acid
- CAS No.: 2055014-94-1
- Formula:C20H36O10
- Molecular Weight:436.49
IUPAC Name: 4,7,10,13,16,19,22,25-octaoxaoctacos-27-ynoic acid
InChIKey: QZQUQXNQKWZDNM-UHFFFAOYSA-N
SMILES: C#CCOCCOCCOCCOCCOCCOCCOCCOCCC(O)=O
Biological Activity: Propargyl-PEG8-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Propargyl-PEG8-acid is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). The ADCs can be used in bacterial infections caused by Gram-negative bacteria[1]. Propargyl-PEG8-acid is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Propargyl-PEG8-acid | 98.0% | Propargyl-PEG8-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Propargyl-PEG8-acid is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). The ADCs can be used in bacterial infections caused by Gram-negative bacteria. Propargyl-PEG8-acid is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||