2067339-51-7
Chemical Structure
PYBG-TMR
- CAS No.: 2067339-51-7
- Formula:C40H35N7O5
- Molecular Weight:693.75
IUPAC Name: 4-(3-((4-(((2-amino-9H-purin-6-yl)oxy)methyl)benzyl)oxy)prop-1-yn-1-yl)-2-(6-(dimethylamino)-3-(dimethyliminio)-3H-xanthen-9-yl)benzoate
InChIKey: RUDZHJCKRLNSJZ-UHFFFAOYSA-N
SMILES: NC1=NC(OCC2=CC=C(COCC#CC3=CC(C(C(C=CC(N(C)C)=C4)=C4O5)=C6C5=C/C(C=C6)=[N+](C)\C)=C(C([O-])=O)C=C3)C=C2)=C7N=CNC7=N1
Biological Activity: PYBG-TMR is a dye and has a role as a fluorochrome. PYBG-TMR specifically and efficiently labels the target genetically encoded SNAP-tags in live cells[1]. PYBG-TMR is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
PYBG-TMR | PYBG-TMR is a dye and has a role as a fluorochrome. PYBG-TMR specifically and efficiently labels the target genetically encoded SNAP-tags in live cells. PYBG-TMR is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
