2090706-08-2
Chemical Structure
Antibacterial agent 259
- CAS No.: 2090706-08-2
- Formula:C7H6ClN3O2S
- Molecular Weight:231.66
SMILES: ClC1=CC=CN2C1=NN=C2S(=O)(C)=O
Biological Activity: Antibacterial agent 259 (K3) is a bactericide, with EC50 values of 1.5, 1.7 and 4.9 mg/L for Xoo, Xoc and Xac, respectively. Antibacterial agent 259 can induce pathogens to produce reactive oxygen species (ROS), leading to their death. Antibacterial agent 259 can be used in the prevention and control of plant bacterial diseases[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Antibacterial agent 259 | Antibacterial agent 259 (K3) is a bactericide, with EC50 values of 1.5, 1.7 and 4.9 mg/L for Xoo, Xoc and Xac, respectively. Antibacterial agent 259 can induce pathogens to produce reactive oxygen species (ROS), leading to their death. Antibacterial agent 259 can be used in the prevention and control of plant bacterial diseases. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||