2093152-77-1
Chemical Structure
Propargyl-PEG7-NHS ester
- CAS No.: 2093152-77-1
- Formula:C22H35NO11
- Molecular Weight:489.51
IUPAC Name: 2,5-dioxopyrrolidin-1-yl 4,7,10,13,16,19,22-heptaoxapentacos-24-ynoate
InChIKey: ZVLITXJWZOQGHB-UHFFFAOYSA-N
SMILES: C#CCOCCOCCOCCOCCOCCOCCOCCC(ON1C(CCC1=O)=O)=O
Biological Activity: Propargyl-PEG7-NHS ester is a PEG/Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs. Propargyl-PEG7-NHS ester is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. Propargyl-PEG7-NHS ester is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Propargyl-PEG7-NHS ester | Propargyl-PEG7-NHS ester is a PEG/Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs. Propargyl-PEG7-NHS ester is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Propargyl-PEG7-NHS ester is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||