2100306-61-2
Chemical Structure
Aminooxy-PEG4-azide
- CAS No.: 2100306-61-2
- Formula:C10H22N4O5
- Molecular Weight:278.31
IUPAC Name: O-(14-azido-3,6,9,12-tetraoxatetradecyl)hydroxylamine
InChIKey: LGQSVZJZFYJANR-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCOCCOCCON
Biological Activity: Aminooxy-PEG4-azide is a PEG-based PROTAC linker can be used in the synthesis of PROTACs[1]. Aminooxy-PEG4-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Aminooxy-PEG4-azide | 99.81% | Aminooxy-PEG4-azide is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Aminooxy-PEG4-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||