2158322-26-8
Chemical Structure
E3 Ligase Ligand-linker Conjugate 201
- CAS No.: 2158322-26-8
- Formula:C46H52N6O11
- Molecular Weight:864.94
SMILES: O=C(C1=CC=C(C=C1)C(NCCOCCOCC(O)=O)=O)N2C3=CC(C#N)=CC=C3N(C([C@H]([C@@H]2C)NC([C@H](C)N(C)C(OC(C)(C)C)=O)=O)=O)CC4=C(OC)C=CC5=C4C=CC=C5
Biological Activity: E3 Ligase Ligand-linker Conjugate 201 is a synthesized E3 ligase ligand-linker conjugate that can be used in the synthesis of PROTACs, such as PROTAC ER Degrader-3 (HY-128527)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
E3 Ligase Ligand-linker Conjugate 201 | E3 Ligase Ligand-linker Conjugate 201 is a synthesized E3 ligase ligand-linker conjugate that can be used in the synthesis of PROTACs, such as PROTAC ER Degrader-3 (HY-128527). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||