2173092-98-1
Chemical Structure
H2N-PEG2-N3 (TosOH)
- CAS No.: 2173092-98-1
- Formula:C13H22N4O5S
- Molecular Weight:346.40
IUPAC Name: 2-(2-(2-azidoethoxy)ethoxy)ethan-1-amine 4-methylbenzenesulfonate
InChIKey: CMBIRCPXWWMTQE-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCN.O=S(O)(C1=CC=C(C)C=C1)=O
Biological Activity: H2N-PEG2-N3 (TosOH) is a click chemistry reagent containing an Azide. N3-PEG2-Amine is used as a Click-chemistry linker in various applications[1]. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
H2N-PEG2-N3 (TosOH) | H2N-PEG2-N3 (TosOH) is a click chemistry reagent containing an Azide. N3-PEG2-Amine is used as a Click-chemistry linker in various applications. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||