2182601-81-4
Chemical Structure
Azido-PEG8-C1-NHS ester
- CAS No.: 2182601-81-4
- Formula:C22H38N4O12
- Molecular Weight:550.56
IUPAC Name: 2,5-dioxopyrrolidin-1-yl 26-azido-3,6,9,12,15,18,21,24-octaoxahexacosanoate
InChIKey: BWTLXAMVEGXXCJ-UHFFFAOYSA-N
SMILES: O=C(ON1C(CCC1=O)=O)COCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG8-C1-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG8-C1-NHS ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG8-C1-NHS ester | Azido-PEG8-C1-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG8-C1-NHS ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||