220088-42-6
Chemical Structure
Binucleine 2
- CAS No.: 220088-42-6
- Formula:C13H11ClFN5
- Molecular Weight:291.71
IUPAC Name: (E)-N'-(1-(3-chloro-4-fluorophenyl)-4-cyano-1H-pyrazol-5-yl)-N,N-dimethylformimidamide
InChIKey: MNCYLHJHZOUDLB-CAOOACKPSA-N
SMILES: CN(/C=N/C1=C(C=NN1C2=CC=C(C(Cl)=C2)F)C#N)C
Biological Activity: Binucleine 2 is an isoform-specific and ATP-competitive inhibitor of Drosophila Aurora B kinase (Ki=0.36 μM), a kinase involved in cell division. It is specific for Drosophila Aurora B kinase, inhibiting it in a dose-dependent manner, with minimal inhibition of human or X. laevis Aurora B kinases at concentrations up to 100 μM. Binucleine 2 induces mitotic and cytokinesis defects in Drosophila Kc167 cells. It prevents Drosophila S2 cells from assembling a contractile ring during cell division when used at a concentration of 40 μM but does not affect ring ingression, suggesting that Aurora B kinase activity is not required for that step.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Binucleine 2 | Binucleine 2 is an isoform-specific and ATP-competitive inhibitor of Drosophila Aurora B kinase (Ki=0.36 μM), a kinase involved in cell division. It is specific for Drosophila Aurora B kinase, inhibiting it in a dose-dependent manner, with minimal inhibition of human or X. laevis Aurora B kinases at concentrations up to 100 μM. Binucleine 2 induces mitotic and cytokinesis defects in Drosophila Kc167 cells. It prevents Drosophila S2 cells from assembling a contractile ring during cell division when used at a concentration of 40 μM but does not affect ring ingression, suggesting that Aurora B kinase activity is not required for that step. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
