2229713-97-5
Chemical Structure
ER ligand-8
- CAS No.: 2229713-97-5
- Formula:C30H27F9O4S
- Molecular Weight:654.58
SMILES: O=S(OC1=CC=C([C@H]2[C@@H](C3=CC=CC=C3)CCC4=C2C=CC(OC(C)(C)C)=C4)C=C1)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)=O
Biological Activity: ER ligand-8 is an ER (Estrogen Receptor/ERR) ligand that can be used to synthesize the PROTAC molecule ERD-1233 (HY-169367)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
ER ligand-8 | ER ligand-8 is an ER (Estrogen Receptor/ERR) ligand that can be used to synthesize the PROTAC molecule ERD-1233 (HY-169367). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||