223465-79-0
Chemical Structure
Arborcandin D
- CAS No.: 223465-79-0
- Formula:C59H103N13O18
- Molecular Weight:1282.53
SMILES: NC(C(O)CC1C(N[C@](C(N[C@@](C(NC(C(NCC(NCCC(NC(C(N[C@@H](C(N[C@H](C(N[C@@H](C(N1)=O)C)=O)CC(N)=O)=O)CC(N)=O)=O)CCCCCCCC(CCCCCC)=O)=O)=O)=O)CCC(O)CCCCCCCCC)=O)([H])[C@H](O)C)=O)([H])[C@H](O)C)=O)=O
Biological Activity: Arborcandin D is a 1,3-β-glucan synthase inhibitor that serves as an antifungal antibiotic. Arborcandin D exhibits IC50 values of 3 μg/mL and 0.35 μg/mL against Candida albicans and Aspergillus fumigatus, respectively. Additionally, Arborcandin D has an MIC of 4 μg/mL against the genus Candida[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Arborcandin D | Arborcandin D is a 1,3-β-glucan synthase inhibitor that serves as an antifungal antibiotic. Arborcandin D exhibits IC50 values of 3 μg/mL and 0.35 μg/mL against Candida albicans and Aspergillus fumigatus, respectively. Additionally, Arborcandin D has an MIC of 4 μg/mL against the genus Candida. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||