2260679-24-9
Chemical Structure
Immune cell migration-IN-2
- CAS No.: 2260679-24-9
- Formula:C26H22Cl2NO7PS
- Molecular Weight:594.40
IUPAC Name: (2S)-2-(2,6-dichloro-4-(((3-hydroxyphenyl)(methyl)phosphoryl)ethynyl)benzamido)-3-(3-(methylsulfonyl)phenyl)propanoic acid
InChIKey: GFOAULRGMIKMSB-FZBBVYCTSA-N
SMILES: CP(C#CC1=CC(Cl)=C(C(Cl)=C1)C(N[C@H](C(O)=O)CC2=CC(S(C)(=O)=O)=CC=C2)=O)(C3=CC(O)=CC=C3)=O
Biological Activity: Immune cell migration-IN-2 is a potent immune cell migration inhibitor with an EC50 of 13.5 nM in a T-cell adhesion assay. Immune cell migration-IN-2 is extracted from patent WO2019001171, example 11, can be used for dry-eye and other retinal diseases research[1]. Immune cell migration-IN-2 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Immune cell migration-IN-2 | Immune cell migration-IN-2 is a potent immune cell migration inhibitor with an EC50 of 13.5 nM in a T-cell adhesion assay. Immune cell migration-IN-2 is extracted from patent WO2019001171, example 11, can be used for dry-eye and other retinal diseases research. Immune cell migration-IN-2 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords