2304621-31-4
Chemical Structure
IMT1
- CAS No.: 2304621-31-4
- Formula:C21H21NO4
- Molecular Weight:351.40
IUPAC Name: N,N-dimethyl-2-((2-oxo-4-(o-tolyl)-2H-chromen-7-yl)oxy)propanamide
InChIKey: DBIPGWVTQBAHGP-UHFFFAOYSA-N
SMILES: CC(OC1=CC=C(C(O2)=C1)C(C3=CC=CC=C3C)=CC2=O)C(N(C)C)=O
Biological Activity: IMT1 is a first-in-class specific and noncompetitive human mitochondrial RNA polymerase (POLRMT) inhibitor. IMT1 causes a conformational change of POLRMT, which blocks substrate binding and transcription in a dose-dependent way in vitro. IMT1 reduces deoxynucleoside triphosphate levels and citric acid cycle intermediates, resulting in a marked depletion of cellular amino acid levels. IMT1 has the potential for mitochondrial transcription disorders related diseases[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
IMT1 | 99.86% | IMT1 is a first-in-class specific and noncompetitive human mitochondrial RNA polymerase (POLRMT) inhibitor. IMT1 causes a conformational change of POLRMT, which blocks substrate binding and transcription in a dose-dependent way in vitro. IMT1 reduces deoxynucleoside triphosphate levels and citric acid cycle intermediates, resulting in a marked depletion of cellular amino acid levels. IMT1 has the potential for mitochondrial transcription disorders related diseases. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||