2305415-77-2
Chemical Structure
5-(Azidomethyl)-2’-O-(2-methoxyethyl)uridine
- CAS No.: 2305415-77-2
- Formula:C13H19N5O7
- Molecular Weight:357.32
IUPAC Name: 5-(azidomethyl)-1-((2R,3S,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3-(2-methoxyethoxy)tetrahydrofuran-2-yl)pyrimidine-4,6(1H,5H)-dione
InChIKey: ZCGPTBLNXKAPKE-SYGSFJRNSA-N
SMILES: O[C@@H]1[C@H](OCCOC)[C@H](N2C(C(CN=[N+]=[N-])C(N=C2)=O)=O)O[C@@H]1CO
Biological Activity: 5-(Azidomethyl)-2’-O-(2-methoxyethyl)uridine is a thymidine analogue. Analogs of this series have insertional activity towards replicated DNA. They can be used to label cells and track DNA synthesis[1]. 5-(Azidomethyl)-2’-O-(2-methoxyethyl)uridine is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
5-(Azidomethyl)-2’-O-(2-methoxyethyl)uridine | 5-(Azidomethyl)-2’-O-(2-methoxyethyl)uridine is a thymidine analogue. Analogs of this series have insertional activity towards replicated DNA. They can be used to label cells and track DNA synthesis. 5-(Azidomethyl)-2’-O-(2-methoxyethyl)uridine is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
