2353409-70-6
Chemical Structure
MMAF-methyl ester
- CAS No.: 2353409-70-6
- Formula:C40H67N5O8
- Molecular Weight:745.99
IUPAC Name: methyl ((2R,3R)-3-((2S)-1-((4S,5S)-4-((S)-N,3-dimethyl-2-((S)-3-methyl-2-(methylamino)butanamido)butanamido)-3-methoxy-5-methylheptanoyl)pyrrolidin-2-yl)-3-methoxy-2-methylpropanoyl)-L-phenylalaninate
InChIKey: WRVLBJXFSHALRZ-LIMOFVMDSA-N
SMILES: COC([C@H](CC1=CC=CC=C1)NC([C@H](C)[C@H]([C@@]2([H])N(CCC2)C(CC(OC)[C@H]([C@@H](C)CC)N(C)C([C@H](C(C)C)NC([C@@H](NC)C(C)C)=O)=O)=O)OC)=O)=O
Biological Activity: MMAF-methyl ester is a methylated derivative of the tubulin inhibitor MMAF (HY-15579), and serves as a pharmaceutical intermediate for the development of antibody-drug conjugates (ADCs) and small-molecule drug conjugates (SMDCs)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
MMAF-methyl ester | MMAF-methyl ester is a methylated derivative of the tubulin inhibitor MMAF (HY-15579), and serves as a pharmaceutical intermediate for the development of antibody-drug conjugates (ADCs) and small-molecule drug conjugates (SMDCs). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||