2375357-96-1
Chemical Structure
Ferroptosis inducer-1
- CAS No.: 2375357-96-1
- Formula:C25H21ClN2O5
- Molecular Weight:464.90
IUPAC Name: methyl (1S,3R)-2-(2-chloroacetyl)-1-(4-((prop-2-yn-1-yloxy)carbonyl)phenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate
InChIKey: AEFRDVDAQLIGSO-OFNKIYASSA-N
SMILES: ClCC(N1[C@](C2=CC=C(C=C2)C(OCC#C)=O)([H])C3=C(C[C@@H]1C(OC)=O)C4=CC=CC=C4N3)=O
Biological Activity: Ferroptosis inducer-1 (compound BX-3a) is a Ferroptosis inducer with antitumor potential[1]. Ferroptosis inducer-1 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Ferroptosis inducer-1 | 98.80% | Ferroptosis inducer-1 (compound BX-3a) is a Ferroptosis inducer with antitumor potential. Ferroptosis inducer-1 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||