2396407-35-3
Chemical Structure
BING
- CAS No.: 2396407-35-3
- Formula:C67H125N21O15
- Molecular Weight:1464.84
InChIKey: KJFKLHFVUQBYLM-JKJOWENQSA-N
SMILES: O=C(N[C@@H](CCCNC(N)=N)C(N[C@@H]([C@@H](C)CC)C(N[C@@H]([C@@H](C)CC)C(N[C@@H](CC(C)C)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](C)C(N[C@@H](CCC(N)=O)C(NCC(N[C@@H](C)C(N[C@@H](CC(C)C)C(N[C@@H](CCCCN)C(N[C@@H]([C@@H](C)CC)C(O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)[C@H]([C@@H](C)CC)N
Biological Activity: BING is an antimicrobial peptide that can be isolated from Japanese medaka fish. BING shows a broad-spectrum toxicity against pathogenic bacteria including drug-resistant strains. BING induces a deregulation of periplasmic peptidyl-prolyl isomerases in gram-negative bacteria, and reduces the RNA level of cpxR, which plays a crucial role in the development of antimicrobial resistance[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
BING | BING is an antimicrobial peptide that can be isolated from Japanese medaka fish. BING shows a broad-spectrum toxicity against pathogenic bacteria including drug-resistant strains. BING induces a deregulation of periplasmic peptidyl-prolyl isomerases in gram-negative bacteria, and reduces the RNA level of cpxR, which plays a crucial role in the development of antimicrobial resistance. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
