2411681-93-9
Chemical Structure
t-Butoxycarbonyl-PEG2-NHS ester
- CAS No.: 2411681-93-9
- Formula:C16H25NO8
- Molecular Weight:359.37
IUPAC Name: tert-butyl 3-(2-(3-((2,5-dioxopyrrolidin-1-yl)oxy)-3-oxopropoxy)ethoxy)propanoate
InChIKey: LTSOBOMOTXJAAW-UHFFFAOYSA-N
SMILES: O=C(CCOCCOCCC(OC(C)(C)C)=O)ON1C(CCC1=O)=O
Biological Activity: t-Butoxycarbonyl-PEG2-NHS ester has a t-Boc protecting group and an NHS ester moiety. The t-butyl group can be deprotected under acidic conditions. NHS ester can react specifically and efficiently with primary amines such as the side chain of lysine residues or aminosilane-coated surfaces at neutral or slightly basic condition to form a covalent bond. The hydrophilic PEG linker increases the water solubility of the compound in aqueous media.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
t-Butoxycarbonyl-PEG2-NHS ester | t-Butoxycarbonyl-PEG2-NHS ester has a t-Boc protecting group and an NHS ester moiety. The t-butyl group can be deprotected under acidic conditions. NHS ester can react specifically and efficiently with primary amines such as the side chain of lysine residues or aminosilane-coated surfaces at neutral or slightly basic condition to form a covalent bond. The hydrophilic PEG linker increases the water solubility of the compound in aqueous media. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
