2438-80-4
2438-80-4
Chemical Structure
(-)-Fucose
Synonym(s): 6-Desoxygalactose;L-(-)-Fucose; L-Galactomethylose
- CAS No.: 2438-80-4
- Formula:C6H12O5
- Molecular Weight:164.16
IUPAC Name: (2S,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanal
InChIKey: PNNNRSAQSRJVSB-KCDKBNATSA-N
SMILES: O=C[C@H]([C@@H]([C@@H]([C@H](C)O)O)O)O
Biological Activity: (-)-Fucose is classified as a member of the hexoses, plays a role in A and B blood group antigen substructure determination, selectin-mediated leukocyte-endothelial adhesion, and host-microbe interactions. (-)-Fucose is orally active, inhibits CL11-induced inflammatory response in kidney and tumor growth[2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(-)-Fucose | 98.0% | (-)-Fucose is classified as a member of the hexoses, plays a role in A and B blood group antigen substructure determination, selectin-mediated leukocyte-endothelial adhesion, and host-microbe interactions. (-)-Fucose is orally active, inhibits CL11-induced inflammatory response in kidney and tumor growth. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
(-)-Fucose (Standard) | 99.88% | (-)-Fucose (Standard) is the analytical standard of (-)-Fucose. This product is intended for research and analytical applications. (-)-Fucose is classified as a member of the hexoses, plays a role in A and B blood group antigen substructure determination, selectin-mediated leukocyte-endothelial adhesion, and host-microbe interactions. (-)-Fucose is orally active, inhibits CL11-induced inflammatory response in kidney and tumor growth. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
(-)-Fucose-13C-2 | (-)-Fucose-13C-2 is the 13C labeled (-)-Fucose. (-)-Fucose is classified as a member of the hexoses, plays a role in A and B blood group antigen substructure determination, selectin-mediated leukocyte-endothelial adhesion, and host-microbe interacti[ | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
(-)-Fucose-13C-3 | (-)-Fucose-13C-3 is the 13C labeled (-)-Fucose. (-)-Fucose is classified as a member of the hexoses, plays a role in A and B blood group antigen substructure determination, selectin-mediated leukocyte-endothelial adhesion, and host-microbe interacti[ | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
(-)-Fucose-13C-1 | 99.85% | (-)-Fucose-13C-1 is the 13C labeled (-)-Fucose. (-)-Fucose is classified as a member of the hexoses, plays a role in A and B blood group antigen substructure determination, selectin-mediated leukocyte-endothelial adhesion, and host-microbe interacti[ | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
(-)-Fucose-13C | 99.86% | (-)-Fucose-13C is the 13C labeled (-)-Fucose. (-)-Fucose is classified as a member of the hexoses, plays a role in A and B blood group antigen substructure determination, selectin-mediated leukocyte-endothelial adhesion, and host-microbe interacti | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
