24470-48-2
Chemical Structure
Anticopalic acid
- CAS No.: 24470-48-2
- Formula:C20H32O2
- Molecular Weight:304.47
InChIKey: JFQBNOIJWROZGE-VQGREHCUSA-N
SMILES: C[C@@]12[C@](CCC([C@@H]2CC/C(C)=C/C(O)=O)=C)([H])C(C)(CCC1)C
Biological Activity: Anticopalic acid is a labdane-type diterpenoid insect antifeedant that exhibits dose-dependent antifeedant activity against the fall armyworm (Spodoptera frugiperda). Anticopalic acid can be isolated from Vitex hemsleyi. Anticopalic acid may be involved in neuroreceptor-mediated insect taste regulation and could be used to develop environmentally friendly antifeedants targeting lepidopteran pests[1][1].
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Anticopalic acid | Anticopalic acid is a labdane-type diterpenoid insect antifeedant that exhibits dose-dependent antifeedant activity against the fall armyworm (Spodoptera frugiperda). Anticopalic acid can be isolated from Vitex hemsleyi. Anticopalic acid may be involved in neuroreceptor-mediated insect taste regulation and could be used to develop environmentally friendly antifeedants targeting lepidopteran pests. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords