2452300-94-4
Chemical Structure
Dapagliflozin impurity A
- CAS No.: 2452300-94-4
- Formula:C21H25ClO8
- Molecular Weight:440.87
InChIKey: LNALRIDFLCYCGX-XYKZKTJVSA-N
SMILES: O[C@H]1[C@H](C2=CC(C(C3=CC=C(C=C3)OCC)OO)=C(C=C2)Cl)O[C@@H]([C@H]([C@@H]1O)O)CO
Biological Activity: Dapagliflozin impurity A (Compound A) is a dapagliflozin peroxide, a genotoxic impurity, can cause damage to human genetic material at very low concentrations, leading to genetic mutations and possibly tumorigenesis[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Dapagliflozin impurity A | Dapagliflozin impurity A (Compound A) is a dapagliflozin peroxide, a genotoxic impurity, can cause damage to human genetic material at very low concentrations, leading to genetic mutations and possibly tumorigenesis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||