2471972-15-1
Chemical Structure
SGC-CDKL2/AAK1/BMP2K-1
- CAS No.: 2471972-15-1
- Formula:C22H26N4O3S
- Molecular Weight:426.53
InChIKey: IIKPYJZUOZRTIB-UHFFFAOYSA-N
SMILES: O=S(NCC1=CC(C2=CC(NN=C3NC(C4CC4)=O)=C3C=C2)=CC=C1)(CC(C)C)=O
Biological Activity: SGC-CDKL2/AAK1/BMP2K-1 (Compound 9) is a potent and selective CDKL2 (Cyclin-dependent kinase-like 2) inhibitor with an IC50 value of 460 nM. CDKL2 is involved in various biological processes such as tumorigenesis, development, and viral infections. SGC-CDKL2/AAK1/BMP2K-1 serves as a powerful tool for studying the biological functions of CDKL2 and holds promise for research in fields related to cancer, infections, and other diseases[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
SGC-CDKL2/AAK1/BMP2K-1 | 98.55% | SGC-CDKL2/AAK1/BMP2K-1 (Compound 9) is a potent and selective CDKL2 (Cyclin-dependent kinase-like 2) inhibitor with an IC50 value of 460 nM. CDKL2 is involved in various biological processes such as tumorigenesis, development, and viral infections. SGC-CDKL2/AAK1/BMP2K-1 serves as a powerful tool for studying the biological functions of CDKL2 and holds promise for research in fields related to cancer, infections, and other diseases. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||