2489525-81-5
Chemical Structure
GPhos Pd G6
Synonym(s): GPhos Pd G6 TES
- CAS No.: 2489525-81-5
- Formula:C47H70BrO4PPdSi
- Molecular Weight:944.44
InChIKey: ZWGWXQKRKHAWKQ-UHFFFAOYSA-N
SMILES: Br[Pd@]1(C2=CC=C(C(OCC[Si](C)(C)C)=O)C=C2)P(C3CCCCC3)(C4CCCCC4)C5=C(C=CC(OC)=C5C(C(C(C)C)=CC=C6)1=C6C(C)C)OC(C)(C)C
Biological Activity: GPhos Pd G6 (GPhos Pd G6 TES) is a palladium catalyst. GPhos Pd G6 catalyzes the Buchwald-Hartwig amination reaction and promotes C-N bond formation between aryl chlorides and amines. GPhos Pd G6 is a pharmaceutical intermediate used for the synthesis of various active compounds[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
GPhos Pd G6 | 98.0% | GPhos Pd G6 (GPhos Pd G6 TES) is a palladium catalyst. GPhos Pd G6 catalyzes the Buchwald-Hartwig amination reaction and promotes C-N bond formation between aryl chlorides and amines. GPhos Pd G6 is a pharmaceutical intermediate used for the synthesis of various active compounds. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||