252845-37-7
Chemical Structure
Veldoreotide
Synonym(s): DG3173; PTR-3173
- CAS No.: 252845-37-7
- Formula:C60H74N12O10
- Molecular Weight:1123.30
IUPAC Name: 2-((3S,6S,9S,12R,15S,18S)-12,15-bis((1H-indol-3-yl)methyl)-9-(4-aminobutyl)-3,18-dibenzyl-6-((R)-1-hydroxyethyl)-2,5,8,11,14,17,20,25-octaoxo-1,4,7,10,13,16,19,24-octaazacyclooctacosan-1-yl)acetamide
InChIKey: ABFNTRQPWNXUHA-VEVJRHMJSA-N
SMILES: O=C(N[C@@H](C(N[C@H](C(N[C@@](C(N[C@H](C1=O)CC2=CC=CC=C2)=O)([H])[C@H](O)C)=O)CCCCN)=O)CC3=CNC4=CC=CC=C34)[C@@H](NC([C@@H](NC(CCCNC(CCCN1CC(N)=O)=O)=O)CC5=CC=CC=C5)=O)CC6=CNC7=CC=CC=C67
Biological Activity: Veldoreotide (DG3173) a somatostatin analogue, binds to and activate the somatostatin receptors (SSTR) 2, 4, and 5. Veldoreotide inhibits growth hormone (GH) secretion in adenomas compared withOctreotide (HY-P0036). Veldoreotide has the potential to be used as pain modulating agent[1]
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Veldoreotide | Veldoreotide (DG3173) a somatostatin analogue, binds to and activate the somatostatin receptors (SSTR) 2, 4, and 5. Veldoreotide inhibits growth hormone (GH) secretion in adenomas compared withOctreotide (HY-P0036). Veldoreotide has the potential to be used as pain modulating agent | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||