2559734-98-2
Chemical Structure
DYSP-C34
- CAS No.: 2559734-98-2
- Formula:C45H47N5O10
- Molecular Weight:817.88
IUPAC Name: (2-((7S,8S)-3-carboxy-7-(2-carboxyethyl)-18-ethyl-13-((E)-4-methoxystyryl)-2,8,12,17-tetramethyl-7H,8H-porphyrin-5-yl)acetyl)-L-aspartic acid
InChIKey: FRWPZZPCOGEBQM-HWFPWORWSA-N
SMILES: OC(C[C@@H](C(O)=O)NC(C/C1=C(C(C(O)=O)=C/2C)/NC2=C/C(C(CC)=C/3C)=NC3=C/C(N4)=C(/C=C/C5=CC=C(C=C5)OC)C(C)=C4/C=C6[C@@H](C)[C@H](CCC(O)=O)C1=N/6)=O)=O
Biological Activity: DYSP-C34 is a potent, biocompatible, and ultrasound (US)-triggered multifunctional molecular machine. DYSP-C34 has multiple favorable properties, such as improved lipophilic/hydrophilic balance, intensified US-induced ROS production capacity, and better cellular permeability, resulting in the excellent tumor target efficiency and notable sonodynamic therapy (SDT)-mediated tumor regression. DYSP-C34 exhibits mild immunogenicity by stimulating APCs directly[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
DYSP-C34 | DYSP-C34 is a potent, biocompatible, and ultrasound (US)-triggered multifunctional molecular machine. DYSP-C34 has multiple favorable properties, such as improved lipophilic/hydrophilic balance, intensified US-induced ROS production capacity, and better cellular permeability, resulting in the excellent tumor target efficiency and notable sonodynamic therapy (SDT)-mediated tumor regression. DYSP-C34 exhibits mild immunogenicity by stimulating APCs directly. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||