2565792-45-0
Chemical Structure
BCN-DOTA
- CAS No.: 2565792-45-0
- Formula:C29H46N6O9
- Molecular Weight:622.71
InChIKey: BNBPIYJUCNHXJH-BKFWDETESA-N
SMILES: O=C(NCCNC(OC[C@H]1[C@@]2([H])CCC#CCC[C@@]12[H])=O)CN3CCN(CC(O)=O)CCN(CC(O)=O)CCN(CC(O)=O)CC3
Biological Activity: BCN-DOTA is a cyclooctyne-linked DOTA chelator. BCN-DOTA integrates BCN and DOTA, enabling conjugation with azide-functionalized groups via the click chemistry properties of BCN, while binding to metal ions through the coordination capacity of DOTA. BCN-DOTA can serve as a radionuclide-drug conjugate (RDC) to target specific biomolecules, cells or tissues after radiolabeling with zirconium-89. BCN-DOTA is applicable to research related to PET imaging and targeted therapy[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
BCN-DOTA | BCN-DOTA is a cyclooctyne-linked DOTA chelator. BCN-DOTA integrates BCN and DOTA, enabling conjugation with azide-functionalized groups via the click chemistry properties of BCN, while binding to metal ions through the coordination capacity of DOTA. BCN-DOTA can serve as a radionuclide-drug conjugate (RDC) to target specific biomolecules, cells or tissues after radiolabeling with zirconium-89. BCN-DOTA is applicable to research related to PET imaging and targeted therapy. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||