2566404-73-5
Chemical Structure
N3-PEG5-aldehyde
- CAS No.: 2566404-73-5
- Formula:C20H30N4O7
- Molecular Weight:438.47
IUPAC Name: N-(17-azido-3,6,9,12,15-pentaoxaheptadecyl)-4-formylbenzamide
InChIKey: VEASZCUTKBUAIG-UHFFFAOYSA-N
SMILES: [H]C(C(C=C1)=CC=C1C(NCCOCCOCCOCCOCCOCCN=[N+]=[N-])=O)=O
Biological Activity: N3-PEG5-aldehyde is a cleavable 5 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. N3-PEG5-aldehyde is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N3-PEG5-aldehyde | N3-PEG5-aldehyde is a cleavable 5 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). N3-PEG5-aldehyde is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||