2636840-37-2
Chemical Structure
p53 Activator 5
- CAS No.: 2636840-37-2
- Formula:C29H32F6N4O
- Molecular Weight:566.58
IUPAC Name: (1r,4r)-N1-(2-(3-((2-methoxy-4-(trifluoromethyl)phenyl)amino)prop-1-yn-1-yl)-1-(2,2,2-trifluoroethyl)-1H-indol-4-yl)-N4,N4-dimethylcyclohexane-1,4-diamine
InChIKey: PEPYNUAHMQWTFP-MEMLXQNLSA-N
SMILES: COC1=CC(C(F)(F)F)=CC=C1NCC#CC2=CC3=C(C=CC=C3N[C@@H](CC4)CC[C@H]4N(C)C)N2CC(F)(F)F
Biological Activity: p53 Activator 5 (compound 134A) is a potent p53 activator with a SC150 value of <0.05 mM. p53 Activator 5 can bind to mutant p53 and restore the ability of the p53 mutant to bind DNA. p53 Activator 5 shows anti-tumor activity[1]. p53 Activator 5 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
p53 Activator 5 | p53 Activator 5 (compound 134A) is a potent p53 activator with a SC150 value of <0.05 mM. p53 Activator 5 can bind to mutant p53 and restore the ability of the p53 mutant to bind DNA. p53 Activator 5 shows anti-tumor activity. p53 Activator 5 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||