2639395-39-2
Chemical Structure
Methyltetrazine-amido-N-bis(PEG4-acid)
- CAS No.: 2639395-39-2
- Formula:C33H51N5O13
- Molecular Weight:725.78
IUPAC Name: 16-(2-(4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl)acetyl)-4,7,10,13,19,22,25,28-octaoxa-16-azahentriacontanedioic acid
InChIKey: ORVVIADHRAGNIK-UHFFFAOYSA-N
SMILES: O=C(CCOCCOCCOCCOCCN(CCOCCOCCOCCOCCC(O)=O)C(CC1=CC=C(C2=NN=C(C)N=N2)C=C1)=O)O
Biological Activity: Methyltetrazine-amido-N-bis(PEG4-acid) is a click chemistry reagent containing an azide group. Methyltetrazine-amido-N-bis(PEG4-acid) is a PEG derivative that contains a methyltetrazine group and two acid groups. This reagent can react with TCO-containing compounds to form a stable covalent bond without the catalysis of Cu or elevated temperatures. The inverse-electron demand Diels-Alder cycloaddition reaction of TCO with tetrazines is the fastest bioorthogonal reaction with exceptional selectivity. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. PEG linker increases the water solubility of the compound. Reagent grade, for research use only[1]. Methyltetrazine-amido-N-bis(PEG4-acid) is a click chemistry reagent, it contains a Tetrazine group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing TCO groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Methyltetrazine-amido-N-bis(PEG4-acid) | Methyltetrazine-amido-N-bis(PEG4-acid) is a click chemistry reagent containing an azide group. Methyltetrazine-amido-N-bis(PEG4-acid) is a PEG derivative that contains a methyltetrazine group and two acid groups. This reagent can react with TCO-containing compounds to form a stable covalent bond without the catalysis of Cu or elevated temperatures. The inverse-electron demand Diels-Alder cycloaddition reaction of TCO with tetrazines is the fastest bioorthogonal reaction with exceptional selectivity. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. PEG linker increases the water solubility of the compound. Reagent grade, for research use only. Methyltetrazine-amido-N-bis(PEG4-acid) is a click chemistry reagent, it contains a Tetrazine group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing TCO groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||