2714310-77-5
Chemical Structure
TCO-PEG5-NHS ester
- CAS No.: 2714310-77-5
- Formula:C26H42N2O11
- Molecular Weight:558.62
SMILES: O=C(NCCOCCOCCOCCOCCOCCC(ON1C(CCC1=O)=O)=O)OC2CC/C=C\CCC2
Biological Activity: TCO-PEG5-NHS ester is a PEG/Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs. TCO-PEG5-NHS ester is a click chemistry reagent, it contains a TCO group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing Tetrazine groups[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
TCO-PEG5-NHS ester | TCO-PEG5-NHS ester is a PEG/Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs. TCO-PEG5-NHS ester is a click chemistry reagent, it contains a TCO group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing Tetrazine groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||