271574-41-5
Chemical Structure
Arisostatin A
- CAS No.: 271574-41-5
- Formula:C69H100N2O24
- Molecular Weight:1341.53
InChIKey: AARSAHIOMZRJPV-OTUARBEOSA-N
SMILES: [H][C@@]12[C@@](OC3=O)(CC(C=O)=C[C@@H]2O)C(O)=C3C([C@@]4(C)[C@]([H])([C@@H](C)C[C@H](C)[C@@H]5O[C@H]6C[C@@H](O[C@H]7CC[C@@H](O[C@@H]8C[C@@H](O)[C@@H](O[C@H]9CC[C@@H](O)[C@H](C)O9)[C@H](C)O8)[C@H](C)O7)[C@@H](OC(C(C)C)=O)[C@H](C)O6)[C@]5([H])C=C[C@@]4([H])/C(C)=C/C[C@H](O[C@H]%10C[C@@]([N+]([O-])=O)(C)[C@@H](NC(OC)=O)[C@@H](C)O%10)/C(C)=C/1)=O
Biological Activity: Arisostatin A, a microbial secondary metabolite, is an antibiotic against Gram-positive bacteria and shown to possess potent anti-tumor properties. Arisostatin A induces apoptosis through the activation of caspase-3 and reactive oxygen species (ROS) generation in AMC-HN-4 cells[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Arisostatin A | Arisostatin A, a microbial secondary metabolite, is an antibiotic against Gram-positive bacteria and shown to possess potent anti-tumor properties. Arisostatin A induces apoptosis through the activation of caspase-3 and reactive oxygen species (ROS) generation in AMC-HN-4 cells. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||