2737202-63-8
Chemical Structure
(2S,3R)-H-Abu(3-N3)-OH hydrochloride
- CAS No.: 2737202-63-8
- Formula:C4H9ClN4O2
- Molecular Weight:180.59
IUPAC Name: (2S,3R)-2-amino-3-azidobutanoic acid hydrochloride
InChIKey: MWINUACJIVWJPZ-MUWMCQJSSA-N
SMILES: [N-]=[N+]=N[C@H](C)[C@H](N)C(O)=O.Cl
Biological Activity: (2S,3R)-H-Abu(3-N3)-OH (hydrochloride) is a click chemistry reagent containing an azide group[1]. (2S,3R)-H-Abu(3-N3)-OH (hydrochloride) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(2S,3R)-H-Abu(3-N3)-OH hydrochloride | (2S,3R)-H-Abu(3-N3)-OH (hydrochloride) is a click chemistry reagent containing an azide group. (2S,3R)-H-Abu(3-N3)-OH (hydrochloride) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords